CAS 23968-37-8 appears in our catalog under these names: 2-Methylbenzofuran-5-amine hydrochloride, 97%, 2-Methyl-benzofuran-5-ylamine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 1g.
2-methyl-1-benzofuran-5-amine;hydrochloride (CAS 23968-37-8) is a chemical compound with the molecular formula C9H10ClNO and a molecular weight of 183.63 g/mol. IUPAC name: 2-methyl-1-benzofuran-5-amine;hydrochloride. InChIKey: MDVOJFDJZLPIKR-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO |
|---|---|
| Molecular weight | 183.63 g/mol |
| IUPAC name | 2-methyl-1-benzofuran-5-amine;hydrochloride |
| InChIKey | MDVOJFDJZLPIKR-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(O1)C=CC(=C2)N.Cl |
Computed by PubChem (NCBI)