CAS 2397494-05-0 is the registry number for Flumioxazin-monoamide Ammonia Salt. Offered by: TRC. Available pack sizes: 500mg.
Azane;2-[(7-fluoro-3-oxo-4-prop-2-ynyl-1,4-benzoxazin-6-yl)carbamoyl]cyclohexene-1-carboxylic acid (CAS 2397494-05-0) is a chemical compound with the molecular formula C19H20FN3O5 and a molecular weight of 389.4 g/mol. IUPAC name: azane;2-[(7-fluoro-3-oxo-4-prop-2-ynyl-1,4-benzoxazin-6-yl)carbamoyl]cyclohexene-1-carboxylic acid. InChIKey: BPJBTQXDGOZQSR-UHFFFAOYSA-N.
| Molecular formula | C19H20FN3O5 |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | azane;2-[(7-fluoro-3-oxo-4-prop-2-ynyl-1,4-benzoxazin-6-yl)carbamoyl]cyclohexene-1-carboxylic acid |
| InChIKey | BPJBTQXDGOZQSR-UHFFFAOYSA-N |
| SMILES | C#CCN1C(=O)COC2=C1C=C(C(=C2)F)NC(=O)C3=C(CCCC3)C(=O)O.N |
Computed by PubChem (NCBI)