CAS 2397623-70-8 is the registry number for 6-Bromo-2,4-diisopropylpyridin-3-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-2,4-di(propan-2-yl)pyridin-3-amine (CAS 2397623-70-8) is a chemical compound with the molecular formula C11H17BrN2 and a molecular weight of 257.17 g/mol. IUPAC name: 6-bromo-2,4-di(propan-2-yl)pyridin-3-amine. InChIKey: NGTPMQMRDJWQPH-UHFFFAOYSA-N.
| Molecular formula | C11H17BrN2 |
|---|---|
| Molecular weight | 257.17 g/mol |
| IUPAC name | 6-bromo-2,4-di(propan-2-yl)pyridin-3-amine |
| InChIKey | NGTPMQMRDJWQPH-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=NC(=C1N)C(C)C)Br |
Computed by PubChem (NCBI)