Products 2399455-45-7
CAS 2399455-45-7 is the registry number for Lenalidomide 4'-PEG1-azide. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[7-[2-(2-azidoethoxy)ethylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (CAS 2399455-45-7) is a chemical compound with the molecular formula C17H20N6O4 and a molecular weight of 372.4 g/mol. IUPAC name: 3-[7-[2-(2-azidoethoxy)ethylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione. InChIKey: CBXNEHSOULAFIX-UHFFFAOYSA-N.
| Molecular formula | C17H20N6O4 |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | 3-[7-[2-(2-azidoethoxy)ethylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| InChIKey | CBXNEHSOULAFIX-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC=C3NCCOCCN=[N+]=[N-] |
Computed by PubChem (NCBI)