Products 2399455-71-9
CAS 2399455-71-9 is the registry number for Lenalidomide 4'-alkyl-C3-azide. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[7-(3-azidopropylamino)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (CAS 2399455-71-9) is a chemical compound with the molecular formula C16H18N6O3 and a molecular weight of 342.35 g/mol. IUPAC name: 3-[7-(3-azidopropylamino)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione. InChIKey: BUOALKMQQKQMCO-UHFFFAOYSA-N.
| Molecular formula | C16H18N6O3 |
|---|---|
| Molecular weight | 342.35 g/mol |
| IUPAC name | 3-[7-(3-azidopropylamino)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| InChIKey | BUOALKMQQKQMCO-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC=C3NCCCN=[N+]=[N-] |
Computed by PubChem (NCBI)