CAS 2400159-59-1 is the registry number for 4-((4-Chloro-1-methyl-1H-pyrazolo[3,4-b]pyridin-6-yl)amino)tetrahydro-2H-thiopyran 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-N-(1,1-dioxothian-4-yl)-1-methylpyrazolo[5,4-b]pyridin-6-amine (CAS 2400159-59-1) is a chemical compound with the molecular formula C12H15ClN4O2S and a molecular weight of 314.79 g/mol. IUPAC name: 4-chloro-N-(1,1-dioxothian-4-yl)-1-methylpyrazolo[5,4-b]pyridin-6-amine. InChIKey: GCMFOAYPULNVKD-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN4O2S |
|---|---|
| Molecular weight | 314.79 g/mol |
| IUPAC name | 4-chloro-N-(1,1-dioxothian-4-yl)-1-methylpyrazolo[5,4-b]pyridin-6-amine |
| InChIKey | GCMFOAYPULNVKD-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=N1)C(=CC(=N2)NC3CCS(=O)(=O)CC3)Cl |
Computed by PubChem (NCBI)