CAS 24015-83-6 appears in our catalog under these names: 3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Pentadecafluoro-2-nonanol, 1H,1H,1H,2H-Perfluoro-2-nonanol. Offered by: TRC, Dr. Ehrenstorfer, Biosynth. Available pack sizes: 100mg, 50mg, 10mg.
3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononan-2-ol (CAS 24015-83-6) is a chemical compound with the molecular formula C9H5F15O and a molecular weight of 414.11 g/mol. IUPAC name: 3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononan-2-ol. InChIKey: LWKNIRKCYPKSGM-UHFFFAOYSA-N.
| Molecular formula | C9H5F15O |
|---|---|
| Molecular weight | 414.11 g/mol |
| IUPAC name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononan-2-ol |
| InChIKey | LWKNIRKCYPKSGM-UHFFFAOYSA-N |
| SMILES | CC(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)