CAS 2401894-38-8 appears in our catalog under these names: 4-Bromo-2-(4-chloro-2-fluorophenyl)-2-methylbenzo[d][1,3]dioxole, 98%, 4-Bromo-2-(4-chloro-2-fluorophenyl)-2-methylbenzo[d][1,3]dioxole, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg.
4-bromo-2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxole (CAS 2401894-38-8) is a chemical compound with the molecular formula C14H9BrClFO2 and a molecular weight of 343.57 g/mol. IUPAC name: 4-bromo-2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxole. InChIKey: YTVRFDGHHCSNRL-UHFFFAOYSA-N.
| Molecular formula | C14H9BrClFO2 |
|---|---|
| Molecular weight | 343.57 g/mol |
| IUPAC name | 4-bromo-2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxole |
| InChIKey | YTVRFDGHHCSNRL-UHFFFAOYSA-N |
| SMILES | CC1(OC2=C(O1)C(=CC=C2)Br)C3=C(C=C(C=C3)Cl)F |
Computed by PubChem (NCBI)