CAS 2402828-89-9 is the registry number for 8,8-Difluorodispiro(2.0.3{4}.1{3})octan-6-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
8,8-difluorodispiro[2.0.34.13]octan-6-amine;hydrochloride (CAS 2402828-89-9) is a chemical compound with the molecular formula C8H12ClF2N and a molecular weight of 195.64 g/mol. IUPAC name: 8,8-difluorodispiro[2.0.34.13]octan-6-amine;hydrochloride. InChIKey: KEVHVDDGHYNCJK-UHFFFAOYSA-N.
| Molecular formula | C8H12ClF2N |
|---|---|
| Molecular weight | 195.64 g/mol |
| IUPAC name | 8,8-difluorodispiro[2.0.34.13]octan-6-amine;hydrochloride |
| InChIKey | KEVHVDDGHYNCJK-UHFFFAOYSA-N |
| SMILES | C1CC12C3(C2(F)F)CC(C3)N.Cl |
Computed by PubChem (NCBI)