Products 2402829-78-9

CAS 2402829-78-9 is the registry number for 3-Fluoro-1-methyl-1h-pyrazol-4-amine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-fluoro-1-methylpyrazol-4-amine;hydrochloride (CAS 2402829-78-9) is a chemical compound with the molecular formula C4H7ClFN3 and a molecular weight of 151.57 g/mol. IUPAC name: 3-fluoro-1-methylpyrazol-4-amine;hydrochloride. InChIKey: XHVYGPLMCRHXNH-UHFFFAOYSA-N.

Identity
Molecular formulaC4H7ClFN3
Molecular weight151.57 g/mol
IUPAC name3-fluoro-1-methylpyrazol-4-amine;hydrochloride
InChIKeyXHVYGPLMCRHXNH-UHFFFAOYSA-N
SMILESCN1C=C(C(=N1)F)N.Cl

Computed by PubChem (NCBI)