Products 2402831-35-8

CAS 2402831-35-8 is the registry number for 6-Oxo-7-oxa-5-azaspiro[3.4]octane-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-oxo-7-oxa-5-azaspiro[3.4]octane-2-carboxylic acid (CAS 2402831-35-8) is a chemical compound with the molecular formula C7H9NO4 and a molecular weight of 171.15 g/mol. IUPAC name: 6-oxo-7-oxa-5-azaspiro[3.4]octane-2-carboxylic acid. InChIKey: IGXPOTLWCQJQJQ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9NO4
Molecular weight171.15 g/mol
IUPAC name6-oxo-7-oxa-5-azaspiro[3.4]octane-2-carboxylic acid
InChIKeyIGXPOTLWCQJQJQ-UHFFFAOYSA-N
SMILESC1C(CC12COC(=O)N2)C(=O)O

Computed by PubChem (NCBI)