CAS 2403678-39-5 is the registry number for Rel-tert-butyl (((1R,2S,4S)-2-hydroxy-4-(methylsulfonyl)cyclohexyl)methyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[[(1R,2S,4S)-2-hydroxy-4-methylsulfonylcyclohexyl]methyl]carbamate (CAS 2403678-39-5) is a chemical compound with the molecular formula C13H25NO5S and a molecular weight of 307.41 g/mol. IUPAC name: tert-butyl N-[[(1R,2S,4S)-2-hydroxy-4-methylsulfonylcyclohexyl]methyl]carbamate. InChIKey: ZGRRTNOGBXTAFB-VWYCJHECSA-N.
| Molecular formula | C13H25NO5S |
|---|---|
| Molecular weight | 307.41 g/mol |
| IUPAC name | tert-butyl N-[[(1R,2S,4S)-2-hydroxy-4-methylsulfonylcyclohexyl]methyl]carbamate |
| InChIKey | ZGRRTNOGBXTAFB-VWYCJHECSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@H]1CC[C@@H](C[C@@H]1O)S(=O)(=O)C |
Computed by PubChem (NCBI)