CAS 941598-39-6 is the registry number for tert-Butyl N-methyl-N-((1R,4R)-4-(methanesulfonyloxy)cyclohexyl)carbamate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclohexyl] methanesulfonate (CAS 941598-39-6) is a chemical compound with the molecular formula C13H25NO5S and a molecular weight of 307.41 g/mol. IUPAC name: [4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclohexyl] methanesulfonate. InChIKey: VFMAFTPQWVNDMU-UHFFFAOYSA-N.
| Molecular formula | C13H25NO5S |
|---|---|
| Molecular weight | 307.41 g/mol |
| IUPAC name | [4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclohexyl] methanesulfonate |
| InChIKey | VFMAFTPQWVNDMU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C1CCC(CC1)OS(=O)(=O)C |
Computed by PubChem (NCBI)