CAS 240423-53-4 appears in our catalog under these names: Acetic acid (1s,2r)-2-[n-benzyl-n-(mesitylenesulfonyl)amino]-1-phenylpropyl ester, 98%, Acetic Acid (1S,2R)-2-[N-Benzyl-N-(mesitylenesulfonyl)amino]-1-phenylpropyl Ester [Reagent for double aldol reaction], >98.0%(HPLC)(T). Offered by: Combi-blocks, TCI. Available pack sizes: 1g.
[(1S,2R)-2-[benzyl-(2,4,6-trimethylphenyl)sulfonylamino]-1-phenylpropyl] acetate (CAS 240423-53-4) is a chemical compound with the molecular formula C27H31NO4S and a molecular weight of 465.6 g/mol. IUPAC name: [(1S,2R)-2-[benzyl-(2,4,6-trimethylphenyl)sulfonylamino]-1-phenylpropyl] acetate. InChIKey: MCELVTKIIIBSDU-ATIYNZHBSA-N.
| Molecular formula | C27H31NO4S |
|---|---|
| Molecular weight | 465.6 g/mol |
| IUPAC name | [(1S,2R)-2-[benzyl-(2,4,6-trimethylphenyl)sulfonylamino]-1-phenylpropyl] acetate |
| InChIKey | MCELVTKIIIBSDU-ATIYNZHBSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)N(CC2=CC=CC=C2)[C@H](C)[C@H](C3=CC=CC=C3)OC(=O)C)C |
Computed by PubChem (NCBI)