CAS 2404661-20-5 is the registry number for 5-Bromo-3-fluoro-N,N-bis(4-methoxybenzyl)pyridin-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-3-fluoro-N,N-bis[(4-methoxyphenyl)methyl]pyridin-2-amine (CAS 2404661-20-5) is a chemical compound with the molecular formula C21H20BrFN2O2 and a molecular weight of 431.3 g/mol. IUPAC name: 5-bromo-3-fluoro-N,N-bis[(4-methoxyphenyl)methyl]pyridin-2-amine. InChIKey: HQDYTZDIDXLELH-UHFFFAOYSA-N.
| Molecular formula | C21H20BrFN2O2 |
|---|---|
| Molecular weight | 431.3 g/mol |
| IUPAC name | 5-bromo-3-fluoro-N,N-bis[(4-methoxyphenyl)methyl]pyridin-2-amine |
| InChIKey | HQDYTZDIDXLELH-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN(CC2=CC=C(C=C2)OC)C3=C(C=C(C=N3)Br)F |
Computed by PubChem (NCBI)