CAS 2404733-70-4 is the registry number for 3-Bromo-2-(4-bromophenyl)-6-methylimidazo[1,2-a]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
3-bromo-2-(4-bromophenyl)-6-methylimidazo[1,2-a]pyridine (CAS 2404733-70-4) is a chemical compound with the molecular formula C14H10Br2N2 and a molecular weight of 366.05 g/mol. IUPAC name: 3-bromo-2-(4-bromophenyl)-6-methylimidazo[1,2-a]pyridine. InChIKey: ZZCZPWLHAFJGOV-UHFFFAOYSA-N.
| Molecular formula | C14H10Br2N2 |
|---|---|
| Molecular weight | 366.05 g/mol |
| IUPAC name | 3-bromo-2-(4-bromophenyl)-6-methylimidazo[1,2-a]pyridine |
| InChIKey | ZZCZPWLHAFJGOV-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=NC(=C2Br)C3=CC=C(C=C3)Br)C=C1 |
Computed by PubChem (NCBI)