CAS 2404733-79-3 is the registry number for Methyl 3-(benzyloxy)-6-bromo-2-chlorobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
Methyl 6-bromo-2-chloro-3-phenylmethoxybenzoate (CAS 2404733-79-3) is a chemical compound with the molecular formula C15H12BrClO3 and a molecular weight of 355.61 g/mol. IUPAC name: methyl 6-bromo-2-chloro-3-phenylmethoxybenzoate. InChIKey: AIPCCAAFFNHMIE-UHFFFAOYSA-N.
| Molecular formula | C15H12BrClO3 |
|---|---|
| Molecular weight | 355.61 g/mol |
| IUPAC name | methyl 6-bromo-2-chloro-3-phenylmethoxybenzoate |
| InChIKey | AIPCCAAFFNHMIE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1Cl)OCC2=CC=CC=C2)Br |
Computed by PubChem (NCBI)