CAS 2404734-03-6 appears in our catalog under these names: 1-(4-Chlorophenyl)-3,4-diiodo-2,5-dimethyl-1h-pyrrole, 95%, 1-(4-Chlorophenyl)-3,4-diiodo-2,5-dimethyl-1H-pyrrole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
1-(4-chlorophenyl)-3,4-diiodo-2,5-dimethylpyrrole (CAS 2404734-03-6) is a chemical compound with the molecular formula C12H10ClI2N and a molecular weight of 457.47 g/mol. IUPAC name: 1-(4-chlorophenyl)-3,4-diiodo-2,5-dimethylpyrrole. InChIKey: CDEIGSDHPJTUCH-UHFFFAOYSA-N.
| Molecular formula | C12H10ClI2N |
|---|---|
| Molecular weight | 457.47 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-3,4-diiodo-2,5-dimethylpyrrole |
| InChIKey | CDEIGSDHPJTUCH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(N1C2=CC=C(C=C2)Cl)C)I)I |
Computed by PubChem (NCBI)