CAS 2404734-19-4 is the registry number for (4,6-Dibromo-3-ethoxy-2-fluorophenyl)methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
(4,6-dibromo-3-ethoxy-2-fluorophenyl)methanol (CAS 2404734-19-4) is a chemical compound with the molecular formula C9H9Br2FO2 and a molecular weight of 327.97 g/mol. IUPAC name: (4,6-dibromo-3-ethoxy-2-fluorophenyl)methanol. InChIKey: KRICEVKYTVEKID-UHFFFAOYSA-N.
| Molecular formula | C9H9Br2FO2 |
|---|---|
| Molecular weight | 327.97 g/mol |
| IUPAC name | (4,6-dibromo-3-ethoxy-2-fluorophenyl)methanol |
| InChIKey | KRICEVKYTVEKID-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C(=C1F)CO)Br)Br |
Computed by PubChem (NCBI)