Products 2404734-36-5
CAS 2404734-36-5 appears in our catalog under these names: 4-(Benzyloxy)-5-bromo-2,3-difluorobenzoic acid, 4-(Benzyloxy)-5-bromo-2,3-difluorobenzoic acid, 95%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 1g, 5g, 10g, 250mg.
5-bromo-2,3-difluoro-4-phenylmethoxybenzoic acid (CAS 2404734-36-5) is a chemical compound with the molecular formula C14H9BrF2O3 and a molecular weight of 343.12 g/mol. IUPAC name: 5-bromo-2,3-difluoro-4-phenylmethoxybenzoic acid. InChIKey: FLIIJHKLMOJRRO-UHFFFAOYSA-N.
| Molecular formula | C14H9BrF2O3 |
|---|---|
| Molecular weight | 343.12 g/mol |
| IUPAC name | 5-bromo-2,3-difluoro-4-phenylmethoxybenzoic acid |
| InChIKey | FLIIJHKLMOJRRO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C(=C2F)F)C(=O)O)Br |
Computed by PubChem (NCBI)