Products 24053-96-1

CAS 24053-96-1 is the registry number for Adamantane-1-sulfonyl chloride, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Adamantane-1-sulfonyl chloride (CAS 24053-96-1) is a chemical compound with the molecular formula C10H15ClO2S and a molecular weight of 234.74 g/mol. IUPAC name: adamantane-1-sulfonyl chloride. InChIKey: LLZYXOXYBQDLIC-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15ClO2S
Molecular weight234.74 g/mol
IUPAC nameadamantane-1-sulfonyl chloride
InChIKeyLLZYXOXYBQDLIC-UHFFFAOYSA-N
SMILESC1C2CC3CC1CC(C2)(C3)S(=O)(=O)Cl

Computed by PubChem (NCBI)