CAS 24053-96-1 is the registry number for Adamantane-1-sulfonyl chloride, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
Adamantane-1-sulfonyl chloride (CAS 24053-96-1) is a chemical compound with the molecular formula C10H15ClO2S and a molecular weight of 234.74 g/mol. IUPAC name: adamantane-1-sulfonyl chloride. InChIKey: LLZYXOXYBQDLIC-UHFFFAOYSA-N.
| Molecular formula | C10H15ClO2S |
|---|---|
| Molecular weight | 234.74 g/mol |
| IUPAC name | adamantane-1-sulfonyl chloride |
| InChIKey | LLZYXOXYBQDLIC-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)S(=O)(=O)Cl |
Computed by PubChem (NCBI)