CAS 2407087-98-1 is the registry number for N-(3-Chloro-2-fluorophenyl)-6-iodo-7-methoxyquinazolin-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3-chloro-2-fluorophenyl)-6-iodo-7-methoxyquinazolin-4-amine (CAS 2407087-98-1) is a chemical compound with the molecular formula C15H10ClFIN3O and a molecular weight of 429.61 g/mol. IUPAC name: N-(3-chloro-2-fluorophenyl)-6-iodo-7-methoxyquinazolin-4-amine. InChIKey: OLXVIMXSTGINLQ-UHFFFAOYSA-N.
| Molecular formula | C15H10ClFIN3O |
|---|---|
| Molecular weight | 429.61 g/mol |
| IUPAC name | N-(3-chloro-2-fluorophenyl)-6-iodo-7-methoxyquinazolin-4-amine |
| InChIKey | OLXVIMXSTGINLQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)N=CN=C2NC3=C(C(=CC=C3)Cl)F)I |
Computed by PubChem (NCBI)