Products 2407228-20-8
CAS 2407228-20-8 is the registry number for tert-Butyl 2-amino-3-cyano-6,6-dimethyl-6,7-dihydrothieno[3,2-c]pyridine-5(4H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-amino-3-cyano-6,6-dimethyl-4,7-dihydrothieno[3,2-c]pyridine-5-carboxylate (CAS 2407228-20-8) is a chemical compound with the molecular formula C15H21N3O2S and a molecular weight of 307.4 g/mol. IUPAC name: tert-butyl 2-amino-3-cyano-6,6-dimethyl-4,7-dihydrothieno[3,2-c]pyridine-5-carboxylate. InChIKey: GUFIWLVOZDVCFD-UHFFFAOYSA-N.
| Molecular formula | C15H21N3O2S |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | tert-butyl 2-amino-3-cyano-6,6-dimethyl-4,7-dihydrothieno[3,2-c]pyridine-5-carboxylate |
| InChIKey | GUFIWLVOZDVCFD-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(CN1C(=O)OC(C)(C)C)C(=C(S2)N)C#N)C |
Computed by PubChem (NCBI)