Products 1346604-75-8
CAS 1346604-75-8 is the registry number for Didesmethyl Almotriptan-d4. Offered by: TRC. Available pack sizes: 50mg.
1,1,2,2-tetradeuterio-2-[5-(pyrrolidin-1-ylsulfonylmethyl)-1H-indol-3-yl]ethanamine (CAS 1346604-75-8) is a chemical compound with the molecular formula C15H21N3O2S and a molecular weight of 311.4 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-2-[5-(pyrrolidin-1-ylsulfonylmethyl)-1H-indol-3-yl]ethanamine. InChIKey: XLDLLAFWGVDYHM-NZLXMSDQSA-N.
| Molecular formula | C15H21N3O2S |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-2-[5-(pyrrolidin-1-ylsulfonylmethyl)-1H-indol-3-yl]ethanamine |
| InChIKey | XLDLLAFWGVDYHM-NZLXMSDQSA-N |
| SMILES | [2H]C([2H])(C1=CNC2=C1C=C(C=C2)CS(=O)(=O)N3CCCC3)C([2H])([2H])N |
Computed by PubChem (NCBI)