Products 2407610-46-0
CAS 2407610-46-0 appears in our catalog under these names: Tegeprotafib, 99.30%, Tegeprotafib, 98% (HPLC). Offered by: MedChemExpress, Ambeed. Available pack sizes: 1 mg, 5 mg, 25 mg, 10 mg, 50 mg, 100mg.
5-(1-fluoro-3-hydroxy-7-methoxynaphthalen-2-yl)-1,1-dioxo-1,2,5-thiadiazolidin-3-one (CAS 2407610-46-0) is a chemical compound with the molecular formula C13H11FN2O5S and a molecular weight of 326.30 g/mol. IUPAC name: 5-(1-fluoro-3-hydroxy-7-methoxynaphthalen-2-yl)-1,1-dioxo-1,2,5-thiadiazolidin-3-one. InChIKey: CPLSFGHDGOFDRP-UHFFFAOYSA-N.
| Molecular formula | C13H11FN2O5S |
|---|---|
| Molecular weight | 326.30 g/mol |
| IUPAC name | 5-(1-fluoro-3-hydroxy-7-methoxynaphthalen-2-yl)-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| InChIKey | CPLSFGHDGOFDRP-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C(C=C2C=C1)O)N3CC(=O)NS3(=O)=O)F |
Computed by PubChem (NCBI)