Products 2407722-34-1

CAS 2407722-34-1 is the registry number for 3-(Cyclopropyldifluoromethyl)-5-(trifluoromethyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[cyclopropyl(difluoro)methyl]-5-(trifluoromethyl)benzoic acid (CAS 2407722-34-1) is a chemical compound with the molecular formula C12H9F5O2 and a molecular weight of 280.19 g/mol. IUPAC name: 3-[cyclopropyl(difluoro)methyl]-5-(trifluoromethyl)benzoic acid. InChIKey: QOVMSCIEMKCYJT-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9F5O2
Molecular weight280.19 g/mol
IUPAC name3-[cyclopropyl(difluoro)methyl]-5-(trifluoromethyl)benzoic acid
InChIKeyQOVMSCIEMKCYJT-UHFFFAOYSA-N
SMILESC1CC1C(C2=CC(=CC(=C2)C(=O)O)C(F)(F)F)(F)F

Computed by PubChem (NCBI)