Products 2407768-11-8
CAS 2407768-11-8 appears in our catalog under these names: AzGGK, AzGGK, 99.72%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, 10 mg, 25 mg, 50 mg, 5 mg.
(2S)-2-amino-6-[[2-[(2-azidoacetyl)amino]acetyl]amino]hexanoic acid (CAS 2407768-11-8) is a chemical compound with the molecular formula C10H18N6O4 and a molecular weight of 286.29 g/mol. IUPAC name: (2S)-2-amino-6-[[2-[(2-azidoacetyl)amino]acetyl]amino]hexanoic acid. InChIKey: LHBGWFVWCZJIBG-ZETCQYMHSA-N.
| Molecular formula | C10H18N6O4 |
|---|---|
| Molecular weight | 286.29 g/mol |
| IUPAC name | (2S)-2-amino-6-[[2-[(2-azidoacetyl)amino]acetyl]amino]hexanoic acid |
| InChIKey | LHBGWFVWCZJIBG-ZETCQYMHSA-N |
| SMILES | C(CCNC(=O)CNC(=O)CN=[N+]=[N-])C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)