Products 2407810-34-6
CAS 2407810-34-6 is the registry number for 2-Ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[d]oxazole, 97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
2-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole (CAS 2407810-34-6) is a chemical compound with the molecular formula C15H20BNO3 and a molecular weight of 273.14 g/mol. IUPAC name: 2-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole. InChIKey: CJJSANFFINSASS-UHFFFAOYSA-N.
| Molecular formula | C15H20BNO3 |
|---|---|
| Molecular weight | 273.14 g/mol |
| IUPAC name | 2-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole |
| InChIKey | CJJSANFFINSASS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)OC(=N3)CC |
Computed by PubChem (NCBI)