CAS 2407829-76-7 is the registry number for CRBN ligand-679. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-bromo-2-(2,6-dioxopiperidin-3-yl)benzo[de]isoquinoline-1,3-dione (CAS 2407829-76-7) is a chemical compound with the molecular formula C17H11BrN2O4 and a molecular weight of 387.2 g/mol. IUPAC name: 6-bromo-2-(2,6-dioxopiperidin-3-yl)benzo[de]isoquinoline-1,3-dione. InChIKey: IJUYUNFLVOMPIZ-UHFFFAOYSA-N.
| Molecular formula | C17H11BrN2O4 |
|---|---|
| Molecular weight | 387.2 g/mol |
| IUPAC name | 6-bromo-2-(2,6-dioxopiperidin-3-yl)benzo[de]isoquinoline-1,3-dione |
| InChIKey | IJUYUNFLVOMPIZ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C4C(=C(C=C3)Br)C=CC=C4C2=O |
Computed by PubChem (NCBI)