CAS 2407829-89-2 is the registry number for DGY-02-126-O-C-COOH. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxobenzo[de]isoquinolin-5-yl]oxyacetic acid (CAS 2407829-89-2) is a chemical compound with the molecular formula C19H14N2O7 and a molecular weight of 382.3 g/mol. IUPAC name: 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxobenzo[de]isoquinolin-5-yl]oxyacetic acid. InChIKey: WGIQPCGTNVPHSE-UHFFFAOYSA-N.
| Molecular formula | C19H14N2O7 |
|---|---|
| Molecular weight | 382.3 g/mol |
| IUPAC name | 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxobenzo[de]isoquinolin-5-yl]oxyacetic acid |
| InChIKey | WGIQPCGTNVPHSE-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=CC=CC4=CC(=CC(=C43)C2=O)OCC(=O)O |
Computed by PubChem (NCBI)