CAS 2408055-05-8 is the registry number for CUHK242. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-chloro-2-[[4-(3,4-dichlorophenyl)sulfanyl-3-nitrophenyl]methylamino]benzoic acid (CAS 2408055-05-8) is a chemical compound with the molecular formula C20H13Cl3N2O4S and a molecular weight of 483.7 g/mol. IUPAC name: 4-chloro-2-[[4-(3,4-dichlorophenyl)sulfanyl-3-nitrophenyl]methylamino]benzoic acid. InChIKey: GXOLKDKCZWHIKQ-UHFFFAOYSA-N.
| Molecular formula | C20H13Cl3N2O4S |
|---|---|
| Molecular weight | 483.7 g/mol |
| IUPAC name | 4-chloro-2-[[4-(3,4-dichlorophenyl)sulfanyl-3-nitrophenyl]methylamino]benzoic acid |
| InChIKey | GXOLKDKCZWHIKQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CNC2=C(C=CC(=C2)Cl)C(=O)O)[N+](=O)[O-])SC3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)