Products 2408055-45-6
CAS 2408055-45-6 is the registry number for RNAP-σ interaction inhibitor-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-chloro-2-[[4-(3,4-dichlorophenyl)sulfanyl-3-nitrophenyl]sulfonylamino]benzoic acid (CAS 2408055-45-6) is a chemical compound with the molecular formula C19H11Cl3N2O6S2 and a molecular weight of 533.8 g/mol. IUPAC name: 4-chloro-2-[[4-(3,4-dichlorophenyl)sulfanyl-3-nitrophenyl]sulfonylamino]benzoic acid. InChIKey: QHADIMWYNQQXEG-UHFFFAOYSA-N.
| Molecular formula | C19H11Cl3N2O6S2 |
|---|---|
| Molecular weight | 533.8 g/mol |
| IUPAC name | 4-chloro-2-[[4-(3,4-dichlorophenyl)sulfanyl-3-nitrophenyl]sulfonylamino]benzoic acid |
| InChIKey | QHADIMWYNQQXEG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1SC2=C(C=C(C=C2)S(=O)(=O)NC3=C(C=CC(=C3)Cl)C(=O)O)[N+](=O)[O-])Cl)Cl |
Computed by PubChem (NCBI)