Products 2408241-62-1
CAS 2408241-62-1 is the registry number for Vamagloxistat. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[4-[4-(3,3-difluorocyclobutyl)phenyl]phenoxy]-1H-triazole-5-carboxylic acid (CAS 2408241-62-1) is a chemical compound with the molecular formula C19H15F2N3O3 and a molecular weight of 371.3 g/mol. IUPAC name: 4-[4-[4-(3,3-difluorocyclobutyl)phenyl]phenoxy]-1H-triazole-5-carboxylic acid. InChIKey: DIQJDWGODFNEHC-UHFFFAOYSA-N.
| Molecular formula | C19H15F2N3O3 |
|---|---|
| Molecular weight | 371.3 g/mol |
| IUPAC name | 4-[4-[4-(3,3-difluorocyclobutyl)phenyl]phenoxy]-1H-triazole-5-carboxylic acid |
| InChIKey | DIQJDWGODFNEHC-UHFFFAOYSA-N |
| SMILES | C1C(CC1(F)F)C2=CC=C(C=C2)C3=CC=C(C=C3)OC4=C(NN=N4)C(=O)O |
Computed by PubChem (NCBI)