CAS 2408429-93-4 is the registry number for 2-(tert-Butyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxazole, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
2-tert-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazole (CAS 2408429-93-4) is a chemical compound with the molecular formula C13H22BNO3 and a molecular weight of 251.13 g/mol. IUPAC name: 2-tert-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazole. InChIKey: ICFGDNXEZDUUBC-UHFFFAOYSA-N.
| Molecular formula | C13H22BNO3 |
|---|---|
| Molecular weight | 251.13 g/mol |
| IUPAC name | 2-tert-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazole |
| InChIKey | ICFGDNXEZDUUBC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(O2)C(C)(C)C |
Computed by PubChem (NCBI)