CAS 24085-07-2 appears in our catalog under these names: 2-Acetoxy-5-(2-bromoacetyl)benzyl acetate, 95%, 2-Acetoxy-5-(2-bromoacetyl)benzyl acetate, 95+%, 2-Acetoxy-5-(2-bromoacetyl)benzyl acetate, 95%, 95%, 4-Acetoxy-3-acetoxymethyl-Alpha-bromoacetophenone, 4-Acetoxy-3-acetoxymethyl-a-bromoacetophenone. Offered by: Combi-blocks, Fluorochem, Chemat, TRC. Available pack sizes: 250mg, 100mg, 1g, 5g, 50mg.
[2-acetyloxy-5-(2-bromoacetyl)phenyl]methyl acetate (CAS 24085-07-2) is a chemical compound with the molecular formula C13H13BrO5 and a molecular weight of 329.14 g/mol. IUPAC name: [2-acetyloxy-5-(2-bromoacetyl)phenyl]methyl acetate. InChIKey: QVJPOKCPMZBJOX-UHFFFAOYSA-N.
| Molecular formula | C13H13BrO5 |
|---|---|
| Molecular weight | 329.14 g/mol |
| IUPAC name | [2-acetyloxy-5-(2-bromoacetyl)phenyl]methyl acetate |
| InChIKey | QVJPOKCPMZBJOX-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1=C(C=CC(=C1)C(=O)CBr)OC(=O)C |
Computed by PubChem (NCBI)