Products 2408666-21-5
CAS 2408666-21-5 is the registry number for 1-(Azetidin-3-ylmethyl)-1H-pyrazole 2,2,2-trifluoroacetate, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(azetidin-3-ylmethyl)pyrazole;2,2,2-trifluoroacetic acid (CAS 2408666-21-5) is a chemical compound with the molecular formula C9H12F3N3O2 and a molecular weight of 251.21 g/mol. IUPAC name: 1-(azetidin-3-ylmethyl)pyrazole;2,2,2-trifluoroacetic acid. InChIKey: RFOPDBSRCHVPRK-UHFFFAOYSA-N.
| Molecular formula | C9H12F3N3O2 |
|---|---|
| Molecular weight | 251.21 g/mol |
| IUPAC name | 1-(azetidin-3-ylmethyl)pyrazole;2,2,2-trifluoroacetic acid |
| InChIKey | RFOPDBSRCHVPRK-UHFFFAOYSA-N |
| SMILES | C1C(CN1)CN2C=CC=N2.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)