CAS 2408686-80-4 is the registry number for (R)-6-Fluoro-3,9-dimethyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R)-6-fluoro-3,9-dimethyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole (CAS 2408686-80-4) is a chemical compound with the molecular formula C13H15FN2 and a molecular weight of 218.27 g/mol. IUPAC name: (3R)-6-fluoro-3,9-dimethyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole. InChIKey: HCYRURRDRPPBTQ-MRVPVSSYSA-N.
| Molecular formula | C13H15FN2 |
|---|---|
| Molecular weight | 218.27 g/mol |
| IUPAC name | (3R)-6-fluoro-3,9-dimethyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole |
| InChIKey | HCYRURRDRPPBTQ-MRVPVSSYSA-N |
| SMILES | C[C@@H]1CC2=C(CN1)C3=C(C=CC(=C3N2)F)C |
Computed by PubChem (NCBI)