CAS 2408686-99-5 is the registry number for (S)-6-Fluoro-8-methoxy-3-methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-6-fluoro-8-methoxy-3-methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole (CAS 2408686-99-5) is a chemical compound with the molecular formula C13H15FN2O and a molecular weight of 234.27 g/mol. IUPAC name: (3S)-6-fluoro-8-methoxy-3-methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole. InChIKey: PCKCKTFOKKJXDI-ZETCQYMHSA-N.
| Molecular formula | C13H15FN2O |
|---|---|
| Molecular weight | 234.27 g/mol |
| IUPAC name | (3S)-6-fluoro-8-methoxy-3-methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole |
| InChIKey | PCKCKTFOKKJXDI-ZETCQYMHSA-N |
| SMILES | C[C@H]1CC2=C(CN1)C3=C(N2)C(=CC(=C3)OC)F |
Computed by PubChem (NCBI)