Products 2408705-92-8

CAS 2408705-92-8 appears in our catalog under these names: 2,4-Dichloro-6-(dibenzo[b,d]furan-1-yl)-1,3,5-triazine, 95%, 95%, 2,4-Dichloro-6-(dibenzo[b,d]furan-1-yl)-1,3,5-triazine, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 1g, 5g, 10g, 25g, 100g.

Structural formula: {0} (CAS {1})

2,4-dichloro-6-dibenzofuran-1-yl-1,3,5-triazine (CAS 2408705-92-8) is a chemical compound with the molecular formula C15H7Cl2N3O and a molecular weight of 316.1 g/mol. IUPAC name: 2,4-dichloro-6-dibenzofuran-1-yl-1,3,5-triazine. InChIKey: MVIZMTZULYQCLR-UHFFFAOYSA-N.

Identity
Molecular formulaC15H7Cl2N3O
Molecular weight316.1 g/mol
IUPAC name2,4-dichloro-6-dibenzofuran-1-yl-1,3,5-triazine
InChIKeyMVIZMTZULYQCLR-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C3=C(C=CC=C3O2)C4=NC(=NC(=N4)Cl)Cl

Computed by PubChem (NCBI)