Products 2408842-93-1
CAS 2408842-93-1 is the registry number for 2-Chloro-9-(4-hydroxy-4-methylcyclohexyl)-7-methyl-7,9-dihydro-8H-purin-8-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-9-(4-hydroxy-4-methylcyclohexyl)-7-methylpurin-8-one (CAS 2408842-93-1) is a chemical compound with the molecular formula C13H17ClN4O2 and a molecular weight of 296.75 g/mol. IUPAC name: 2-chloro-9-(4-hydroxy-4-methylcyclohexyl)-7-methylpurin-8-one. InChIKey: YRLCSYSBYGZTQN-UHFFFAOYSA-N.
| Molecular formula | C13H17ClN4O2 |
|---|---|
| Molecular weight | 296.75 g/mol |
| IUPAC name | 2-chloro-9-(4-hydroxy-4-methylcyclohexyl)-7-methylpurin-8-one |
| InChIKey | YRLCSYSBYGZTQN-UHFFFAOYSA-N |
| SMILES | CC1(CCC(CC1)N2C3=NC(=NC=C3N(C2=O)C)Cl)O |
Computed by PubChem (NCBI)