CAS 2409582-16-5 is the registry number for 4,6-Dichloro-3-iodo-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazolo[3,4-d]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dichloro-3-iodo-1-(oxan-2-yl)pyrazolo[5,4-d]pyrimidine (CAS 2409582-16-5) is a chemical compound with the molecular formula C10H9Cl2IN4O and a molecular weight of 399.01 g/mol. IUPAC name: 4,6-dichloro-3-iodo-1-(oxan-2-yl)pyrazolo[5,4-d]pyrimidine. InChIKey: WSZMAFUZWMFUNF-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2IN4O |
|---|---|
| Molecular weight | 399.01 g/mol |
| IUPAC name | 4,6-dichloro-3-iodo-1-(oxan-2-yl)pyrazolo[5,4-d]pyrimidine |
| InChIKey | WSZMAFUZWMFUNF-UHFFFAOYSA-N |
| SMILES | C1CCOC(C1)N2C3=C(C(=NC(=N3)Cl)Cl)C(=N2)I |
Computed by PubChem (NCBI)