Products 2409959-99-3

CAS 2409959-99-3 is the registry number for YOK-2204, 98.64%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 25 mg, 10 mg, 100 mg, 50 mg.

Structural formula: {0} (CAS {1})

(2R)-1-[3,4-bis(2-phenylethoxy)phenoxy]-3-(propan-2-ylamino)propan-2-ol (CAS 2409959-99-3) is a chemical compound with the molecular formula C28H35NO4 and a molecular weight of 449.6 g/mol. IUPAC name: (2R)-1-[3,4-bis(2-phenylethoxy)phenoxy]-3-(propan-2-ylamino)propan-2-ol. InChIKey: VUEHBSCURSXAMY-RUZDIDTESA-N.

Identity
Molecular formulaC28H35NO4
Molecular weight449.6 g/mol
IUPAC name(2R)-1-[3,4-bis(2-phenylethoxy)phenoxy]-3-(propan-2-ylamino)propan-2-ol
InChIKeyVUEHBSCURSXAMY-RUZDIDTESA-N
SMILESCC(C)NC[C@H](COC1=CC(=C(C=C1)OCCC2=CC=CC=C2)OCCC3=CC=CC=C3)O

Computed by PubChem (NCBI)