CAS 2409960-12-7 is the registry number for YT 6-2 analog-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R)-2-[[3,4-bis[(4-fluorophenyl)methoxy]phenoxy]methyl]oxirane (CAS 2409960-12-7) is a chemical compound with the molecular formula C23H20F2O4 and a molecular weight of 398.4 g/mol. IUPAC name: (2R)-2-[[3,4-bis[(4-fluorophenyl)methoxy]phenoxy]methyl]oxirane. InChIKey: GNDKFAQABPKYKM-NRFANRHFSA-N.
| Molecular formula | C23H20F2O4 |
|---|---|
| Molecular weight | 398.4 g/mol |
| IUPAC name | (2R)-2-[[3,4-bis[(4-fluorophenyl)methoxy]phenoxy]methyl]oxirane |
| InChIKey | GNDKFAQABPKYKM-NRFANRHFSA-N |
| SMILES | C1[C@@H](O1)COC2=CC(=C(C=C2)OCC3=CC=C(C=C3)F)OCC4=CC=C(C=C4)F |
Computed by PubChem (NCBI)