Products 2409964-40-3

CAS 2409964-40-3 is the registry number for PXS-4787 (hydrochloride), 99.71%. Offered by: MedChemExpress. Available pack sizes: 10mM/1mL, 5 mg, 50 mg, 25 mg, 10 mg, 100 mg.

Structural formula: {0} (CAS {1})

(Z)-4-(benzenesulfonyl)-3-fluorobut-2-en-1-amine;hydrochloride (CAS 2409964-40-3) is a chemical compound with the molecular formula C10H13ClFNO2S and a molecular weight of 265.73 g/mol. IUPAC name: (Z)-4-(benzenesulfonyl)-3-fluorobut-2-en-1-amine;hydrochloride. InChIKey: GTHSNTGBWPOOQA-BORNJIKYSA-N.

Identity
Molecular formulaC10H13ClFNO2S
Molecular weight265.73 g/mol
IUPAC name(Z)-4-(benzenesulfonyl)-3-fluorobut-2-en-1-amine;hydrochloride
InChIKeyGTHSNTGBWPOOQA-BORNJIKYSA-N
SMILESC1=CC=C(C=C1)S(=O)(=O)C/C(=C/CN)/F.Cl

Computed by PubChem (NCBI)