CAS 2409969-94-2 appears in our catalog under these names: m-Peg10-acid, 95%, m–PEG10–acid, m-PEG10-acid, 95%, 95%, m-PEG10-acid, 98.0%, m-PEG10-acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 250mg, 1g, 1mg, 5mg, 100mg, 5g, 50 mg, 25 mg.
3-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2409969-94-2) is a chemical compound with the molecular formula C22H44O12 and a molecular weight of 500.6 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: DWDMPMQTMMOYQC-UHFFFAOYSA-N.
| Molecular formula | C22H44O12 |
|---|---|
| Molecular weight | 500.6 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | DWDMPMQTMMOYQC-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)