CAS 2410195-20-7 appears in our catalog under these names: N-(4-Methyl-3-((4-(pyridin-3-yl)pyrimidin-2-yl)amino)phenyl)formamide, 98%, Imatinib Impurity 9. Offered by: Chemat Brand. Available pack sizes: on request.
N-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]formamide (CAS 2410195-20-7) is a chemical compound with the molecular formula C17H15N5O and a molecular weight of 305.33 g/mol. IUPAC name: N-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]formamide. InChIKey: CHDWAILIXXMHQN-UHFFFAOYSA-N.
| Molecular formula | C17H15N5O |
|---|---|
| Molecular weight | 305.33 g/mol |
| IUPAC name | N-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]formamide |
| InChIKey | CHDWAILIXXMHQN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC=O)NC2=NC=CC(=N2)C3=CN=CC=C3 |
Computed by PubChem (NCBI)