CAS 1001083-56-2 appears in our catalog under these names: Zaleplon-d5, Zaleplon-d5, >95% (HPLC), Zaleplon-d5 (N-ethyl-d5), 99 atom % D, min 98% Chemical Purity. Offered by: Chemat Brand, Hubei YoungXin, TRC, CDN. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 0,05g.
N-[3-(3-cyanopyrazolo[1,5-a]pyrimidin-7-yl)phenyl]-N-(1,1,2,2,2-pentadeuterioethyl)acetamide (CAS 1001083-56-2) is a chemical compound with the molecular formula C17H15N5O and a molecular weight of 310.36 g/mol. IUPAC name: N-[3-(3-cyanopyrazolo[1,5-a]pyrimidin-7-yl)phenyl]-N-(1,1,2,2,2-pentadeuterioethyl)acetamide. InChIKey: HUNXMJYCHXQEGX-WNWXXORZSA-N.
| Molecular formula | C17H15N5O |
|---|---|
| Molecular weight | 310.36 g/mol |
| IUPAC name | N-[3-(3-cyanopyrazolo[1,5-a]pyrimidin-7-yl)phenyl]-N-(1,1,2,2,2-pentadeuterioethyl)acetamide |
| InChIKey | HUNXMJYCHXQEGX-WNWXXORZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N(C1=CC=CC(=C1)C2=CC=NC3=C(C=NN23)C#N)C(=O)C |
Computed by PubChem (NCBI)