CAS 2410561-64-5 is the registry number for FM-1088. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-fluoro-2-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-3H-isoindol-1-one (CAS 2410561-64-5) is a chemical compound with the molecular formula C17H12F5NOS and a molecular weight of 373.3 g/mol. IUPAC name: 6-fluoro-2-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-3H-isoindol-1-one. InChIKey: APOIQOZTFBZFMF-UHFFFAOYSA-N.
| Molecular formula | C17H12F5NOS |
|---|---|
| Molecular weight | 373.3 g/mol |
| IUPAC name | 6-fluoro-2-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-3H-isoindol-1-one |
| InChIKey | APOIQOZTFBZFMF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1SCC(F)(F)F)N2CC3=C(C2=O)C=C(C=C3)F)F |
Computed by PubChem (NCBI)