CAS 2410594-78-2 appears in our catalog under these names: Rel-(1R,3R,4S)-3-hydroxybicyclo(2.1.0)pentane-1-carboxylic acid, 95%, rac-(1R,3R,4S)-3-Hydroxybicyclo(2.1.0)pentane-1-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 0,5g, 50mg.
(1R,3R,4S)-3-hydroxybicyclo[2.1.0]pentane-1-carboxylic acid (CAS 2410594-78-2) is a chemical compound with the molecular formula C6H8O3 and a molecular weight of 128.13 g/mol. IUPAC name: (1R,3R,4S)-3-hydroxybicyclo[2.1.0]pentane-1-carboxylic acid. InChIKey: QNKKPMSKYVHIFK-ZMIZWQJLSA-N.
| Molecular formula | C6H8O3 |
|---|---|
| Molecular weight | 128.13 g/mol |
| IUPAC name | (1R,3R,4S)-3-hydroxybicyclo[2.1.0]pentane-1-carboxylic acid |
| InChIKey | QNKKPMSKYVHIFK-ZMIZWQJLSA-N |
| SMILES | C1[C@H]2[C@@]1(C[C@H]2O)C(=O)O |
Computed by PubChem (NCBI)