CAS 2410640-38-7 is the registry number for tert-Butyl 7-bromo-2,3-dihydro-1H-pyrrolo[2,3-b]quinoline-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 7-bromo-2,3-dihydropyrrolo[2,3-b]quinoline-1-carboxylate (CAS 2410640-38-7) is a chemical compound with the molecular formula C16H17BrN2O2 and a molecular weight of 349.22 g/mol. IUPAC name: tert-butyl 7-bromo-2,3-dihydropyrrolo[2,3-b]quinoline-1-carboxylate. InChIKey: XIGZOFXMTNMLAU-UHFFFAOYSA-N.
| Molecular formula | C16H17BrN2O2 |
|---|---|
| Molecular weight | 349.22 g/mol |
| IUPAC name | tert-butyl 7-bromo-2,3-dihydropyrrolo[2,3-b]quinoline-1-carboxylate |
| InChIKey | XIGZOFXMTNMLAU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C1N=C3C=C(C=CC3=C2)Br |
Computed by PubChem (NCBI)